About 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine
4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine (PubChem CID 70327411) has the molecular formula C21H28FN3O
and a molecular weight of 357.47 g/mol. Its IUPAC name is 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine.
Molecular Properties
| Compound Name | 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine |
| PubChem CID | 70327411 |
| Molecular Formula | C21H28FN3O |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine |
| SMILES | CC(C)Oc1cccc(CN2CCC(N)(Nc3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C21H28FN3O/c1-16(2)26-20-8-3-5-17(13-20)15-25-11-9-21(23,10-12-25)24-19-7-4-6-18(22)14-19/h3-8,13-14,16,24H,9-12,15,23H2,1-2H3 |
| InChIKey | UFGXHZLKFGOAIC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine?
The IUPAC name of 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine (CID 70327411) is 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine.
What is the SMILES notation for 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine?
The canonical SMILES for 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine is CC(C)Oc1cccc(CN2CCC(N)(Nc3cccc(F)c3)CC2)c1.
What is the InChIKey of 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine?
The InChIKey is UFGXHZLKFGOAIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28FN3O/c1-16(2)26-20-8-3-5-17(13-20)15-25-11-9-21(23,10-12-25)24-19-7-4-6-18(22)14-19/h3-8,13-14,16,24H,9-12,15,23H2,1-2H3.
What are the key properties of 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine?
4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine has a molecular weight of 357.47 g/mol, XLogP of 3.98, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N'-(3-fluorophenyl)-1-[(3-propan-2-yloxyphenyl)methyl]piperidine-4,4-diamine is sourced from PubChem (CID 70327411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).