C32H43NO5 — CID 70327464
benzyl 4-methoxy-2-[[1-[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propylcarbamoyl]cyclohexyl]methyl]butanoate (PubChem CID 70327464) has the molecular formula C32H43NO5 and a molecular weight of 521.70 g/mol. Its IUPAC name is benzyl 4-methoxy-2-[[1-[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propylcarbamoyl]cyclohexyl]methyl]butanoate.
| Compound Name | benzyl 4-methoxy-2-[[1-[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propylcarbamoyl]cyclohexyl]methyl]butanoate |
|---|---|
| PubChem CID | 70327464 |
| Molecular Formula | C32H43NO5 |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | benzyl 4-methoxy-2-[[1-[3-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propylcarbamoyl]cyclohexyl]methyl]butanoate |
| SMILES | COCCC(CC1(C(=O)NCCCc2ccc3c(c2)CC(C)O3)CCCCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H43NO5/c1-24-20-28-21-25(13-14-29(28)38-24)12-9-18-33-31(35)32(16-7-4-8-17-32)22-27(15-19-36-2)30(34)37-23-26-10-5-3-6-11-26/h3,5-6,10-11,13-14,21,24,27H,4,7-9,12,15-20,22-23H2,1-2H3,(H,33,35) |
| InChIKey | MHBAJNWPQMAKBM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|