About 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid
3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid (PubChem CID 70327887) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid |
| PubChem CID | 70327887 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid |
| SMILES | O=C(O)CCC1OC(c2ccccc2)O1 |
| InChI | InChI=1S/C11H12O4/c12-9(13)6-7-10-14-11(15-10)8-4-2-1-3-5-8/h1-5,10-11H,6-7H2,(H,12,13) |
| InChIKey | GRKGITZAUAKKCK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid?
The IUPAC name of 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid (CID 70327887) is 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid.
What is the SMILES notation for 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid?
The canonical SMILES for 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid is O=C(O)CCC1OC(c2ccccc2)O1.
What is the InChIKey of 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid?
The InChIKey is GRKGITZAUAKKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c12-9(13)6-7-10-14-11(15-10)8-4-2-1-3-5-8/h1-5,10-11H,6-7H2,(H,12,13).
What are the key properties of 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid?
3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid has a molecular weight of 208.21 g/mol, XLogP of 1.92, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-phenyl-1,3-dioxetan-2-yl)propanoic acid is sourced from PubChem (CID 70327887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).