About N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide
N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide (PubChem CID 70328072) has the molecular formula C18H20FN5O
and a molecular weight of 341.39 g/mol. Its IUPAC name is N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide.
Molecular Properties
| Compound Name | N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide |
| PubChem CID | 70328072 |
| Molecular Formula | C18H20FN5O |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide |
| SMILES | CC(C)(C)CCN(NC(=O)c1ccc(F)cc1)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C18H20FN5O/c1-18(2,3)9-11-24(16-8-10-21-15(12-20)22-16)23-17(25)13-4-6-14(19)7-5-13/h4-8,10H,9,11H2,1-3H3,(H,23,25) |
| InChIKey | YKABFZNTGALTKH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide?
The IUPAC name of N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide (CID 70328072) is N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide.
What is the SMILES notation for N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide?
The canonical SMILES for N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide is CC(C)(C)CCN(NC(=O)c1ccc(F)cc1)c1ccnc(C#N)n1.
What is the InChIKey of N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide?
The InChIKey is YKABFZNTGALTKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN5O/c1-18(2,3)9-11-24(16-8-10-21-15(12-20)22-16)23-17(25)13-4-6-14(19)7-5-13/h4-8,10H,9,11H2,1-3H3,(H,23,25).
What are the key properties of N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide?
N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide has a molecular weight of 341.39 g/mol, XLogP of 3.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-cyanopyrimidin-4-yl)-N'-(3,3-dimethylbutyl)-4-fluorobenzohydrazide is sourced from PubChem (CID 70328072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).