C15H17N3OS — CID 70328122
(3R,6S,7aS)-6-benzyl-6-(methylamino)-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile (PubChem CID 70328122) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is (3R,6S,7aS)-6-benzyl-6-(methylamino)-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile.
| Compound Name | (3R,6S,7aS)-6-benzyl-6-(methylamino)-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile |
|---|---|
| PubChem CID | 70328122 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (3R,6S,7aS)-6-benzyl-6-(methylamino)-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile |
| SMILES | CN[C@@]1(Cc2ccccc2)C[C@@H]2SC[C@@H](C#N)N2C1=O |
| InChI | InChI=1S/C15H17N3OS/c1-17-15(7-11-5-3-2-4-6-11)8-13-18(14(15)19)12(9-16)10-20-13/h2-6,12-13,17H,7-8,10H2,1H3/t12-,13+,15+/m1/s1 |
| InChIKey | UDMMXVSVCPLPQD-IPYPFGDCSA-N |
| XLogP | 1.38 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |