C10H15NOS — CID 70328461
5-methylsulfinyl-1,2,3,4,7,8-hexahydroisoquinoline (PubChem CID 70328461) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 5-methylsulfinyl-1,2,3,4,7,8-hexahydroisoquinoline.
| Compound Name | 5-methylsulfinyl-1,2,3,4,7,8-hexahydroisoquinoline |
|---|---|
| PubChem CID | 70328461 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 5-methylsulfinyl-1,2,3,4,7,8-hexahydroisoquinoline |
| SMILES | CS(=O)C1=CCCC2=C1CCNC2 |
| InChI | InChI=1S/C10H15NOS/c1-13(12)10-4-2-3-8-7-11-6-5-9(8)10/h4,11H,2-3,5-7H2,1H3 |
| InChIKey | ZSEMFJIFKOGKQI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |