C16H19NO2 — CID 70328464
3-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)-3a,4-dihydro-1H-indole (PubChem CID 70328464) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)-3a,4-dihydro-1H-indole.
| Compound Name | 3-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)-3a,4-dihydro-1H-indole |
|---|---|
| PubChem CID | 70328464 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-(4,5-dimethoxycyclohexa-1,5-dien-1-yl)-3a,4-dihydro-1H-indole |
| SMILES | COC1=CC(C2=CNC3=CC=CCC32)=CCC1OC |
| InChI | InChI=1S/C16H19NO2/c1-18-15-8-7-11(9-16(15)19-2)13-10-17-14-6-4-3-5-12(13)14/h3-4,6-7,9-10,12,15,17H,5,8H2,1-2H3 |
| InChIKey | GOWNATRNUFBCSO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |