C15H26O6 — CID 70329302
ethyl (2R,3R)-3-butoxy-3-(4-methyl-1,3-dioxetan-2-yl)-2-prop-2-enoxypropanoate (PubChem CID 70329302) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethyl (2R,3R)-3-butoxy-3-(4-methyl-1,3-dioxetan-2-yl)-2-prop-2-enoxypropanoate.
| Compound Name | ethyl (2R,3R)-3-butoxy-3-(4-methyl-1,3-dioxetan-2-yl)-2-prop-2-enoxypropanoate |
|---|---|
| PubChem CID | 70329302 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | ethyl (2R,3R)-3-butoxy-3-(4-methyl-1,3-dioxetan-2-yl)-2-prop-2-enoxypropanoate |
| SMILES | C=CCO[C@@H](C(=O)OCC)[C@@H](OCCCC)C1OC(C)O1 |
| InChI | InChI=1S/C15H26O6/c1-5-8-10-19-13(15-20-11(4)21-15)12(18-9-6-2)14(16)17-7-3/h6,11-13,15H,2,5,7-10H2,1,3-4H3/t11?,12-,13-,15?/m1/s1 |
| InChIKey | SNYNGVXCUVLKJW-DNCHLWJUSA-N |
| XLogP | 2.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|