C11H10Br2Cl2O2 — CID 7032956
(5R,6R)-5,6-dibromo-2-(2,4-dichlorophenyl)-1,3-dioxepane (PubChem CID 7032956) has the molecular formula C11H10Br2Cl2O2 and a molecular weight of 404.91 g/mol. Its IUPAC name is (5R,6R)-5,6-dibromo-2-(2,4-dichlorophenyl)-1,3-dioxepane.
| Compound Name | (5R,6R)-5,6-dibromo-2-(2,4-dichlorophenyl)-1,3-dioxepane |
|---|---|
| PubChem CID | 7032956 |
| Molecular Formula | C11H10Br2Cl2O2 |
| Molecular Weight | 404.91 g/mol |
| Exact Mass | 401.84 |
| IUPAC Name | (5R,6R)-5,6-dibromo-2-(2,4-dichlorophenyl)-1,3-dioxepane |
| SMILES | Clc1ccc(C2OC[C@@H](Br)[C@H](Br)CO2)c(Cl)c1 |
| InChI | InChI=1S/C11H10Br2Cl2O2/c12-8-4-16-11(17-5-9(8)13)7-2-1-6(14)3-10(7)15/h1-3,8-9,11H,4-5H2/t8-,9-/m1/s1 |
| InChIKey | HGAWYKFXGMWDSI-RKDXNWHRSA-N |
| XLogP | 4.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.91 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|