C30H43NO4Si — CID 70330094
tert-butyl 4-[(E,4R)-6-[hydroxy(diphenyl)silyl]-6-methylhept-2-en-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 70330094) has the molecular formula C30H43NO4Si and a molecular weight of 509.76 g/mol. Its IUPAC name is tert-butyl 4-[(E,4R)-6-[hydroxy(diphenyl)silyl]-6-methylhept-2-en-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-[(E,4R)-6-[hydroxy(diphenyl)silyl]-6-methylhept-2-en-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 70330094 |
| Molecular Formula | C30H43NO4Si |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | tert-butyl 4-[(E,4R)-6-[hydroxy(diphenyl)silyl]-6-methylhept-2-en-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C/C=C/[C@@H](CC(C)(C)[Si](O)(c1ccccc1)c1ccccc1)C1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H43NO4Si/c1-9-16-23(26-22-34-30(7,8)31(26)27(32)35-28(2,3)4)21-29(5,6)36(33,24-17-12-10-13-18-24)25-19-14-11-15-20-25/h9-20,23,26,33H,21-22H2,1-8H3/b16-9+/t23-,26?/m0/s1 |
| InChIKey | LZIXEAVBXMTYIZ-RHOGOBMYSA-N |
| XLogP | 5.47 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|