C22H31NO2Si — CID 70330096
(E,2R,3R)-2-amino-3-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]hex-4-en-1-ol (PubChem CID 70330096) has the molecular formula C22H31NO2Si and a molecular weight of 369.58 g/mol. Its IUPAC name is (E,2R,3R)-2-amino-3-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]hex-4-en-1-ol.
| Compound Name | (E,2R,3R)-2-amino-3-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]hex-4-en-1-ol |
|---|---|
| PubChem CID | 70330096 |
| Molecular Formula | C22H31NO2Si |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (E,2R,3R)-2-amino-3-[2-[hydroxy(diphenyl)silyl]-2-methylpropyl]hex-4-en-1-ol |
| SMILES | C/C=C/[C@@H](CC(C)(C)[Si](O)(c1ccccc1)c1ccccc1)[C@@H](N)CO |
| InChI | InChI=1S/C22H31NO2Si/c1-4-11-18(21(23)17-24)16-22(2,3)26(25,19-12-7-5-8-13-19)20-14-9-6-10-15-20/h4-15,18,21,24-25H,16-17,23H2,1-3H3/b11-4+/t18-,21-/m0/s1 |
| InChIKey | ULEZQFFNVCJSQE-RQTPQESZSA-N |
| XLogP | 2.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|