About N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide
N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide (PubChem CID 70330309) has the molecular formula C24H27N3O3
and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide.
Molecular Properties
| Compound Name | N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide |
| PubChem CID | 70330309 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide |
| SMILES | CN(CCc1ccccc1)C(=O)CCC(=O)NCc1nc(Cc2ccccc2)co1 |
| InChI | InChI=1S/C24H27N3O3/c1-27(15-14-19-8-4-2-5-9-19)24(29)13-12-22(28)25-17-23-26-21(18-30-23)16-20-10-6-3-7-11-20/h2-11,18H,12-17H2,1H3,(H,25,28) |
| InChIKey | FGQDMPGBSTWWFP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide?
The IUPAC name of N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide (CID 70330309) is N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide.
What is the SMILES notation for N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide?
The canonical SMILES for N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide is CN(CCc1ccccc1)C(=O)CCC(=O)NCc1nc(Cc2ccccc2)co1.
What is the InChIKey of N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide?
The InChIKey is FGQDMPGBSTWWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O3/c1-27(15-14-19-8-4-2-5-9-19)24(29)13-12-22(28)25-17-23-26-21(18-30-23)16-20-10-6-3-7-11-20/h2-11,18H,12-17H2,1H3,(H,25,28).
What are the key properties of N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide?
N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide has a molecular weight of 405.50 g/mol, XLogP of 3.36, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-benzyl-1,3-oxazol-2-yl)methyl]-N'-methyl-N'-(2-phenylethyl)butanediamide is sourced from PubChem (CID 70330309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).