About 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine
2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine (PubChem CID 70330892) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine |
| PubChem CID | 70330892 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine |
| SMILES | Cc1nc2c(n1C(C)C)CCC=N2 |
| InChI | InChI=1S/C10H15N3/c1-7(2)13-8(3)12-10-9(13)5-4-6-11-10/h6-7H,4-5H2,1-3H3 |
| InChIKey | PCDZFQXRTWYXTA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine?
The IUPAC name of 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine (CID 70330892) is 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine.
What is the SMILES notation for 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine?
The canonical SMILES for 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine is Cc1nc2c(n1C(C)C)CCC=N2.
What is the InChIKey of 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine?
The InChIKey is PCDZFQXRTWYXTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-7(2)13-8(3)12-10-9(13)5-4-6-11-10/h6-7H,4-5H2,1-3H3.
What are the key properties of 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine?
2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine has a molecular weight of 177.25 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-propan-2-yl-6,7-dihydroimidazo[4,5-b]pyridine is sourced from PubChem (CID 70330892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).