C9H13NO3 — CID 70331140
(3S,3aS,6aR)-2-methyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 70331140) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-methyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | (3S,3aS,6aR)-2-methyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 70331140 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (3S,3aS,6aR)-2-methyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | CN1C[C@@H]2C(=O)CC[C@@H]2[C@H]1C(=O)O |
| InChI | InChI=1S/C9H13NO3/c1-10-4-6-5(2-3-7(6)11)8(10)9(12)13/h5-6,8H,2-4H2,1H3,(H,12,13)/t5-,6-,8-/m0/s1 |
| InChIKey | LGONUSCZRZKVDQ-HAFWLYHUSA-N |
| XLogP | -0.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |