C20H31F3N4O4 — CID 70331356
1-(2-amino-3,3-dimethylbutanoyl)-N-[6,6,6-trifluoro-1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 70331356) has the molecular formula C20H31F3N4O4 and a molecular weight of 448.49 g/mol. Its IUPAC name is 1-(2-amino-3,3-dimethylbutanoyl)-N-[6,6,6-trifluoro-1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-amino-3,3-dimethylbutanoyl)-N-[6,6,6-trifluoro-1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70331356 |
| Molecular Formula | C20H31F3N4O4 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-(2-amino-3,3-dimethylbutanoyl)-N-[6,6,6-trifluoro-1,2-dioxo-1-(prop-2-enylamino)hexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CCC(F)(F)F)NC(=O)C1CCCN1C(=O)C(N)C(C)(C)C |
| InChI | InChI=1S/C20H31F3N4O4/c1-5-10-25-17(30)14(28)12(8-9-20(21,22)23)26-16(29)13-7-6-11-27(13)18(31)15(24)19(2,3)4/h5,12-13,15H,1,6-11,24H2,2-4H3,(H,25,30)(H,26,29) |
| InChIKey | FOXSWDFZBUBCKU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|