About 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene
4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene (PubChem CID 70331713) has the molecular formula C9H13FO
and a molecular weight of 156.20 g/mol. Its IUPAC name is 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene.
Analyze 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene?
The IUPAC name of 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene (CID 70331713) is 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene is COC1=C(C)C=C(F)CC1C.
What is the InChIKey of 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene?
The InChIKey is PBWDRXSYQWZIKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FO/c1-6-4-8(10)5-7(2)9(6)11-3/h4,7H,5H2,1-3H3.
What are the key properties of 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene?
4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene has a molecular weight of 156.20 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-methoxy-2,6-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 70331713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).