C28H45F3O5Si — CID 70331792
(4S,10E,13E)-16-acetyl-5,5,7,9-tetramethyl-4-triethylsilyloxy-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 70331792) has the molecular formula C28H45F3O5Si and a molecular weight of 546.74 g/mol. Its IUPAC name is (4S,10E,13E)-16-acetyl-5,5,7,9-tetramethyl-4-triethylsilyloxy-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,10E,13E)-16-acetyl-5,5,7,9-tetramethyl-4-triethylsilyloxy-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 70331792 |
| Molecular Formula | C28H45F3O5Si |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | (4S,10E,13E)-16-acetyl-5,5,7,9-tetramethyl-4-triethylsilyloxy-13-(trifluoromethyl)-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC(=O)OC(C(C)=O)C/C=C(/C(F)(F)F)C/C=C/C(C)CC(C)C(=O)C1(C)C |
| InChI | InChI=1S/C28H45F3O5Si/c1-9-37(10-2,11-3)36-24-18-25(33)35-23(21(6)32)16-15-22(28(29,30)31)14-12-13-19(4)17-20(5)26(34)27(24,7)8/h12-13,15,19-20,23-24H,9-11,14,16-18H2,1-8H3/b13-12+,22-15+/t19?,20?,23?,24-/m0/s1 |
| InChIKey | VJZRVAYTCBNYQD-YOOSQGPSSA-N |
| XLogP | 7.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|