C25H39BFN3O5 — CID 70332006
1-[(2R)-2-amino-3-(4-fluorophenyl)propanoyl]-N-[4-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxamide (PubChem CID 70332006) has the molecular formula C25H39BFN3O5 and a molecular weight of 491.41 g/mol. Its IUPAC name is 1-[(2R)-2-amino-3-(4-fluorophenyl)propanoyl]-N-[4-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(2R)-2-amino-3-(4-fluorophenyl)propanoyl]-N-[4-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70332006 |
| Molecular Formula | C25H39BFN3O5 |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 1-[(2R)-2-amino-3-(4-fluorophenyl)propanoyl]-N-[4-methoxy-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]pyrrolidine-2-carboxamide |
| SMILES | COCCCC(NC(=O)C1CCCN1C(=O)[C@H](N)Cc1ccc(F)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H39BFN3O5/c1-24(2)25(3,4)35-26(34-24)21(9-7-15-33-5)29-22(31)20-8-6-14-30(20)23(32)19(28)16-17-10-12-18(27)13-11-17/h10-13,19-21H,6-9,14-16,28H2,1-5H3,(H,29,31)/t19-,20?,21?/m1/s1 |
| InChIKey | QQRDESNUOWSPQQ-QNGMFEMESA-N |
| XLogP | 2.23 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|