About (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol
(2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol (PubChem CID 70332374) has the molecular formula C20H25F2NOS
and a molecular weight of 365.49 g/mol. Its IUPAC name is (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol.
Molecular Properties
| Compound Name | (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol |
| PubChem CID | 70332374 |
| Molecular Formula | C20H25F2NOS |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol |
| SMILES | O[C@@H](CCc1cc(F)cc(F)c1)CNC1(c2cccs2)CCCCC1 |
| InChI | InChI=1S/C20H25F2NOS/c21-16-11-15(12-17(22)13-16)6-7-18(24)14-23-20(8-2-1-3-9-20)19-5-4-10-25-19/h4-5,10-13,18,23-24H,1-3,6-9,14H2/t18-/m0/s1 |
| InChIKey | FDPSICGCCYSYID-SFHVURJKSA-N |
| XLogP | 4.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol?
The IUPAC name of (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol (CID 70332374) is (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol.
What is the SMILES notation for (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol?
The canonical SMILES for (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol is O[C@@H](CCc1cc(F)cc(F)c1)CNC1(c2cccs2)CCCCC1.
What is the InChIKey of (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol?
The InChIKey is FDPSICGCCYSYID-SFHVURJKSA-N. The full InChI is InChI=1S/C20H25F2NOS/c21-16-11-15(12-17(22)13-16)6-7-18(24)14-23-20(8-2-1-3-9-20)19-5-4-10-25-19/h4-5,10-13,18,23-24H,1-3,6-9,14H2/t18-/m0/s1.
What are the key properties of (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol?
(2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol has a molecular weight of 365.49 g/mol, XLogP of 4.77, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-(3,5-difluorophenyl)-1-[(1-thiophen-2-ylcyclohexyl)amino]butan-2-ol is sourced from PubChem (CID 70332374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).