About 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide
2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide (PubChem CID 70333061) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide.
Molecular Properties
| Compound Name | 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide |
| PubChem CID | 70333061 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide |
| SMILES | CC(=O)N[C@H]1CCC[C@@H](C(C)(C)C(N)=O)C1 |
| InChI | InChI=1S/C12H22N2O2/c1-8(15)14-10-6-4-5-9(7-10)12(2,3)11(13)16/h9-10H,4-7H2,1-3H3,(H2,13,16)(H,14,15)/t9-,10+/m1/s1 |
| InChIKey | FGOGGOFNWCZVMM-ZJUUUORDSA-N |
| XLogP | 1.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide?
The IUPAC name of 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide (CID 70333061) is 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide.
What is the SMILES notation for 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide?
The canonical SMILES for 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide is CC(=O)N[C@H]1CCC[C@@H](C(C)(C)C(N)=O)C1.
What is the InChIKey of 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide?
The InChIKey is FGOGGOFNWCZVMM-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-8(15)14-10-6-4-5-9(7-10)12(2,3)11(13)16/h9-10H,4-7H2,1-3H3,(H2,13,16)(H,14,15)/t9-,10+/m1/s1.
What are the key properties of 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide?
2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide has a molecular weight of 226.32 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,3S)-3-acetamidocyclohexyl]-2-methylpropanamide is sourced from PubChem (CID 70333061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).