About 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide
2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 70333092) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 70333092 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | CCNC1=C(C(N)=O)C=CCC1 |
| InChI | InChI=1S/C9H14N2O/c1-2-11-8-6-4-3-5-7(8)9(10)12/h3,5,11H,2,4,6H2,1H3,(H2,10,12) |
| InChIKey | SWIDJJNPDYDLKU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide (CID 70333092) is 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide is CCNC1=C(C(N)=O)C=CCC1.
What is the InChIKey of 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide?
The InChIKey is SWIDJJNPDYDLKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-2-11-8-6-4-3-5-7(8)9(10)12/h3,5,11H,2,4,6H2,1H3,(H2,10,12).
What are the key properties of 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide?
2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide has a molecular weight of 166.22 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)cyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 70333092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).