C30H37N5O3 — CID 70333170
N,N-diethyl-2-[[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,8,11(15),17,20-heptaen-7-yl]oxy]acetamide (PubChem CID 70333170) has the molecular formula C30H37N5O3 and a molecular weight of 515.66 g/mol. Its IUPAC name is N,N-diethyl-2-[[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,8,11(15),17,20-heptaen-7-yl]oxy]acetamide.
| Compound Name | N,N-diethyl-2-[[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,8,11(15),17,20-heptaen-7-yl]oxy]acetamide |
|---|---|
| PubChem CID | 70333170 |
| Molecular Formula | C30H37N5O3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | N,N-diethyl-2-[[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4,8,11(15),17,20-heptaen-7-yl]oxy]acetamide |
| SMILES | CCN(CC)C(=O)COC1C=c2c(n(CC(C)C)c3c4c(c5c(c23)CNC5=O)-c2cn(C)nc2CC4)=CC1 |
| InChI | InChI=1S/C30H37N5O3/c1-6-34(7-2)25(36)16-38-18-8-11-24-20(12-18)27-21-13-31-30(37)28(21)26-19(29(27)35(24)14-17(3)4)9-10-23-22(26)15-33(5)32-23/h11-12,15,17-18H,6-10,13-14,16H2,1-5H3,(H,31,37) |
| InChIKey | BWUHOFDASJPHBZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|