C12H16N2 — CID 70334212
2-methyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole (PubChem CID 70334212) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-methyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole.
| Compound Name | 2-methyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 70334212 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-methyl-1,3,4,4b,8a,9-hexahydropyrido[3,4-b]indole |
| SMILES | CN1CCC2=C(C1)NC1C=CC=CC21 |
| InChI | InChI=1S/C12H16N2/c1-14-7-6-10-9-4-2-3-5-11(9)13-12(10)8-14/h2-5,9,11,13H,6-8H2,1H3 |
| InChIKey | PTGDFTCSBWRXRO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |