C13H20N2O — CID 70334325
(2E)-6-(1,2-dihydropyridin-6-yloxy)-2-methylhepta-2,6-dien-1-amine (PubChem CID 70334325) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is (2E)-6-(1,2-dihydropyridin-6-yloxy)-2-methylhepta-2,6-dien-1-amine.
| Compound Name | (2E)-6-(1,2-dihydropyridin-6-yloxy)-2-methylhepta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 70334325 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (2E)-6-(1,2-dihydropyridin-6-yloxy)-2-methylhepta-2,6-dien-1-amine |
| SMILES | C=C(CC/C=C(\C)CN)OC1=CC=CCN1 |
| InChI | InChI=1S/C13H20N2O/c1-11(10-14)6-5-7-12(2)16-13-8-3-4-9-15-13/h3-4,6,8,15H,2,5,7,9-10,14H2,1H3/b11-6+ |
| InChIKey | KYRQCGNOLPZKOW-IZZDOVSWSA-N |
| XLogP | 2.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|