C10H13N3 — CID 70334651
3-cyclohexa-2,4-dien-1-yl-5-ethyl-1H-1,2,4-triazole (PubChem CID 70334651) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-cyclohexa-2,4-dien-1-yl-5-ethyl-1H-1,2,4-triazole.
| Compound Name | 3-cyclohexa-2,4-dien-1-yl-5-ethyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 70334651 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3-cyclohexa-2,4-dien-1-yl-5-ethyl-1H-1,2,4-triazole |
| SMILES | CCc1nc(C2C=CC=CC2)n[nH]1 |
| InChI | InChI=1S/C10H13N3/c1-2-9-11-10(13-12-9)8-6-4-3-5-7-8/h3-6,8H,2,7H2,1H3,(H,11,12,13) |
| InChIKey | BYWGTOWUWCCHJW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |