C9H11F5N2O — CID 70334851
(3Z)-3-ethylidene-4,4-difluoro-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide (PubChem CID 70334851) has the molecular formula C9H11F5N2O and a molecular weight of 258.19 g/mol. Its IUPAC name is (3Z)-3-ethylidene-4,4-difluoro-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide.
| Compound Name | (3Z)-3-ethylidene-4,4-difluoro-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70334851 |
| Molecular Formula | C9H11F5N2O |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (3Z)-3-ethylidene-4,4-difluoro-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
| SMILES | C/C=C1/C(C(=O)NCC(F)(F)F)NCC1(F)F |
| InChI | InChI=1S/C9H11F5N2O/c1-2-5-6(15-3-8(5,10)11)7(17)16-4-9(12,13)14/h2,6,15H,3-4H2,1H3,(H,16,17)/b5-2- |
| InChIKey | ZTKWMTNSIPBRQZ-DJWKRKHSSA-N |
| XLogP | 1.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|