C9H13F2NO — CID 70335691
1-[(3S,3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]ethanone (PubChem CID 70335691) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is 1-[(3S,3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]ethanone.
| Compound Name | 1-[(3S,3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 70335691 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 1-[(3S,3aS,6aR)-5,5-difluoro-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-3-yl]ethanone |
| SMILES | CC(=O)[C@H]1NC[C@@H]2CC(F)(F)C[C@@H]21 |
| InChI | InChI=1S/C9H13F2NO/c1-5(13)8-7-3-9(10,11)2-6(7)4-12-8/h6-8,12H,2-4H2,1H3/t6-,7-,8+/m0/s1 |
| InChIKey | OKLNLDXGBPAWAM-BIIVOSGPSA-N |
| XLogP | 1.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |