C12H19NO — CID 70335742
1-[(3aS)-1-methyl-3,3a,4,5,8,8a-hexahydro-2H-cyclohepta[b]pyrrol-2-yl]ethanone (PubChem CID 70335742) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-[(3aS)-1-methyl-3,3a,4,5,8,8a-hexahydro-2H-cyclohepta[b]pyrrol-2-yl]ethanone.
| Compound Name | 1-[(3aS)-1-methyl-3,3a,4,5,8,8a-hexahydro-2H-cyclohepta[b]pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 70335742 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-[(3aS)-1-methyl-3,3a,4,5,8,8a-hexahydro-2H-cyclohepta[b]pyrrol-2-yl]ethanone |
| SMILES | CC(=O)C1C[C@@H]2CCC=CCC2N1C |
| InChI | InChI=1S/C12H19NO/c1-9(14)12-8-10-6-4-3-5-7-11(10)13(12)2/h3,5,10-12H,4,6-8H2,1-2H3/t10-,11?,12?/m0/s1 |
| InChIKey | NFAVCKWVYOSCAM-UNXYVOJBSA-N |
| XLogP | 2.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|