About (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine
(2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine (PubChem CID 70335756) has the molecular formula C17H17F2NO
and a molecular weight of 289.32 g/mol. Its IUPAC name is (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine.
Molecular Properties
| Compound Name | (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine |
| PubChem CID | 70335756 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine |
| SMILES | Fc1ccc(C(c2ccccc2)[C@@H]2CNCCO2)c(F)c1 |
| InChI | InChI=1S/C17H17F2NO/c18-13-6-7-14(15(19)10-13)17(12-4-2-1-3-5-12)16-11-20-8-9-21-16/h1-7,10,16-17,20H,8-9,11H2/t16-,17?/m0/s1 |
| InChIKey | JGZAZKAKOJMOEA-BHWOMJMDSA-N |
| XLogP | 3.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine?
The IUPAC name of (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine (CID 70335756) is (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine.
What is the SMILES notation for (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine?
The canonical SMILES for (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine is Fc1ccc(C(c2ccccc2)[C@@H]2CNCCO2)c(F)c1.
What is the InChIKey of (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine?
The InChIKey is JGZAZKAKOJMOEA-BHWOMJMDSA-N. The full InChI is InChI=1S/C17H17F2NO/c18-13-6-7-14(15(19)10-13)17(12-4-2-1-3-5-12)16-11-20-8-9-21-16/h1-7,10,16-17,20H,8-9,11H2/t16-,17?/m0/s1.
What are the key properties of (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine?
(2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine has a molecular weight of 289.32 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2,4-difluorophenyl)-phenylmethyl]morpholine is sourced from PubChem (CID 70335756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).