About 2-methyl-4a,8a-dihydro-1,8-naphthyridine
2-methyl-4a,8a-dihydro-1,8-naphthyridine (PubChem CID 70335790) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-methyl-4a,8a-dihydro-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-methyl-4a,8a-dihydro-1,8-naphthyridine |
| PubChem CID | 70335790 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-methyl-4a,8a-dihydro-1,8-naphthyridine |
| SMILES | CC1=NC2N=CC=CC2C=C1 |
| InChI | InChI=1S/C9H10N2/c1-7-4-5-8-3-2-6-10-9(8)11-7/h2-6,8-9H,1H3 |
| InChIKey | XXHYFNYJMNOBNN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4a,8a-dihydro-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4a,8a-dihydro-1,8-naphthyridine?
The IUPAC name of 2-methyl-4a,8a-dihydro-1,8-naphthyridine (CID 70335790) is 2-methyl-4a,8a-dihydro-1,8-naphthyridine.
What is the SMILES notation for 2-methyl-4a,8a-dihydro-1,8-naphthyridine?
The canonical SMILES for 2-methyl-4a,8a-dihydro-1,8-naphthyridine is CC1=NC2N=CC=CC2C=C1.
What is the InChIKey of 2-methyl-4a,8a-dihydro-1,8-naphthyridine?
The InChIKey is XXHYFNYJMNOBNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-7-4-5-8-3-2-6-10-9(8)11-7/h2-6,8-9H,1H3.
What are the key properties of 2-methyl-4a,8a-dihydro-1,8-naphthyridine?
2-methyl-4a,8a-dihydro-1,8-naphthyridine has a molecular weight of 146.19 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4a,8a-dihydro-1,8-naphthyridine is sourced from PubChem (CID 70335790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).