C21H27BN2O3 — CID 70335844
2-N-[1-(4-methoxyphenyl)ethenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine (PubChem CID 70335844) has the molecular formula C21H27BN2O3 and a molecular weight of 366.27 g/mol. Its IUPAC name is 2-N-[1-(4-methoxyphenyl)ethenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine.
| Compound Name | 2-N-[1-(4-methoxyphenyl)ethenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 70335844 |
| Molecular Formula | C21H27BN2O3 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-N-[1-(4-methoxyphenyl)ethenyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine |
| SMILES | C=C(Nc1cc(B2OC(C)(C)C(C)(C)O2)ccc1N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H27BN2O3/c1-14(15-7-10-17(25-6)11-8-15)24-19-13-16(9-12-18(19)23)22-26-20(2,3)21(4,5)27-22/h7-13,24H,1,23H2,2-6H3 |
| InChIKey | MNJCPBHUVJJHEA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|