C21H21ClF2N7O2+ — CID 70336186
1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-hydroxypyridin-1-ium-2-yl)ethyl]amino]pyrazin-2-one (PubChem CID 70336186) has the molecular formula C21H21ClF2N7O2+ and a molecular weight of 476.90 g/mol. Its IUPAC name is 1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-hydroxypyridin-1-ium-2-yl)ethyl]amino]pyrazin-2-one.
| Compound Name | 1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-hydroxypyridin-1-ium-2-yl)ethyl]amino]pyrazin-2-one |
|---|---|
| PubChem CID | 70336186 |
| Molecular Formula | C21H21ClF2N7O2+ |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 1-[2-[(5-chloro-2H-indazol-3-yl)methylamino]ethyl]-3-[[2,2-difluoro-2-(1-hydroxypyridin-1-ium-2-yl)ethyl]amino]pyrazin-2-one |
| SMILES | O=c1c(NCC(F)(F)c2cccc[n+]2O)nccn1CCNCc1[nH]nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H21ClF2N7O2/c22-14-4-5-16-15(11-14)17(29-28-16)12-25-6-9-30-10-7-26-19(20(30)32)27-13-21(23,24)18-3-1-2-8-31(18)33/h1-5,7-8,10-11,25,33H,6,9,12-13H2,(H,26,27)(H,28,29)/q+1 |
| InChIKey | QUQAUTMWADURAR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|