C20H34FNO2Si — CID 70336713
(1S,3S,4S)-3-fluoro-4-[4-[hydroxy(dimethyl)silyl]-4-methyl-2-phenylpentoxy]cyclohexan-1-amine (PubChem CID 70336713) has the molecular formula C20H34FNO2Si and a molecular weight of 367.58 g/mol. Its IUPAC name is (1S,3S,4S)-3-fluoro-4-[4-[hydroxy(dimethyl)silyl]-4-methyl-2-phenylpentoxy]cyclohexan-1-amine.
| Compound Name | (1S,3S,4S)-3-fluoro-4-[4-[hydroxy(dimethyl)silyl]-4-methyl-2-phenylpentoxy]cyclohexan-1-amine |
|---|---|
| PubChem CID | 70336713 |
| Molecular Formula | C20H34FNO2Si |
| Molecular Weight | 367.58 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | (1S,3S,4S)-3-fluoro-4-[4-[hydroxy(dimethyl)silyl]-4-methyl-2-phenylpentoxy]cyclohexan-1-amine |
| SMILES | CC(C)(CC(CO[C@H]1CC[C@H](N)C[C@@H]1F)c1ccccc1)[Si](C)(C)O |
| InChI | InChI=1S/C20H34FNO2Si/c1-20(2,25(3,4)23)13-16(15-8-6-5-7-9-15)14-24-19-11-10-17(22)12-18(19)21/h5-9,16-19,23H,10-14,22H2,1-4H3/t16?,17-,18-,19-/m0/s1 |
| InChIKey | AKBYOFJNTSMLFU-JGINJTNGSA-N |
| XLogP | 4.37 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|