About 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile
2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile (PubChem CID 70336718) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile |
| PubChem CID | 70336718 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile |
| SMILES | CCNC1=CCC(CC#N)C=C1 |
| InChI | InChI=1S/C10H14N2/c1-2-12-10-5-3-9(4-6-10)7-8-11/h3,5-6,9,12H,2,4,7H2,1H3 |
| InChIKey | ISNFWJVXNCWVTR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile?
The IUPAC name of 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile (CID 70336718) is 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile.
What is the SMILES notation for 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile?
The canonical SMILES for 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile is CCNC1=CCC(CC#N)C=C1.
What is the InChIKey of 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile?
The InChIKey is ISNFWJVXNCWVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-2-12-10-5-3-9(4-6-10)7-8-11/h3,5-6,9,12H,2,4,7H2,1H3.
What are the key properties of 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile?
2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile has a molecular weight of 162.24 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(ethylamino)cyclohexa-2,4-dien-1-yl]acetonitrile is sourced from PubChem (CID 70336718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).