About 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one
2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one (PubChem CID 70337304) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one |
| PubChem CID | 70337304 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one |
| SMILES | CC(C)CN1CC2C=CC=CC2C1=O |
| InChI | InChI=1S/C12H17NO/c1-9(2)7-13-8-10-5-3-4-6-11(10)12(13)14/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | ZUAOYYZUKOWBNU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one?
The IUPAC name of 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one (CID 70337304) is 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one.
What is the SMILES notation for 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one?
The canonical SMILES for 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one is CC(C)CN1CC2C=CC=CC2C1=O.
What is the InChIKey of 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one?
The InChIKey is ZUAOYYZUKOWBNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-9(2)7-13-8-10-5-3-4-6-11(10)12(13)14/h3-6,9-11H,7-8H2,1-2H3.
What are the key properties of 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one?
2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one has a molecular weight of 191.27 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropyl)-3a,7a-dihydro-3H-isoindol-1-one is sourced from PubChem (CID 70337304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).