C27H41N3O4 — CID 70337635
4-cyclopentyl-N-[(2S)-2-hydroxy-2-[(2R,4R)-4-phenoxypyrrolidin-2-yl]ethyl]-5-oxo-1-pentylpyrrolidine-3-carboxamide (PubChem CID 70337635) has the molecular formula C27H41N3O4 and a molecular weight of 471.64 g/mol. Its IUPAC name is 4-cyclopentyl-N-[(2S)-2-hydroxy-2-[(2R,4R)-4-phenoxypyrrolidin-2-yl]ethyl]-5-oxo-1-pentylpyrrolidine-3-carboxamide.
| Compound Name | 4-cyclopentyl-N-[(2S)-2-hydroxy-2-[(2R,4R)-4-phenoxypyrrolidin-2-yl]ethyl]-5-oxo-1-pentylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 70337635 |
| Molecular Formula | C27H41N3O4 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | 4-cyclopentyl-N-[(2S)-2-hydroxy-2-[(2R,4R)-4-phenoxypyrrolidin-2-yl]ethyl]-5-oxo-1-pentylpyrrolidine-3-carboxamide |
| SMILES | CCCCCN1CC(C(=O)NC[C@H](O)[C@H]2C[C@@H](Oc3ccccc3)CN2)C(C2CCCC2)C1=O |
| InChI | InChI=1S/C27H41N3O4/c1-2-3-9-14-30-18-22(25(27(30)33)19-10-7-8-11-19)26(32)29-17-24(31)23-15-21(16-28-23)34-20-12-5-4-6-13-20/h4-6,12-13,19,21-25,28,31H,2-3,7-11,14-18H2,1H3,(H,29,32)/t21-,22?,23-,24+,25?/m1/s1 |
| InChIKey | CNVCWMXIIAZBBA-MNRJOPBOSA-N |
| XLogP | 2.73 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|