C9H14ClNO — CID 70337884
1-[(3S)-5-chloro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]ethanone (PubChem CID 70337884) has the molecular formula C9H14ClNO and a molecular weight of 187.67 g/mol. Its IUPAC name is 1-[(3S)-5-chloro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]ethanone.
| Compound Name | 1-[(3S)-5-chloro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 70337884 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 1-[(3S)-5-chloro-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]ethanone |
| SMILES | CC(=O)[C@H]1NCC2CC(Cl)CC21 |
| InChI | InChI=1S/C9H14ClNO/c1-5(12)9-8-3-7(10)2-6(8)4-11-9/h6-9,11H,2-4H2,1H3/t6?,7?,8?,9-/m1/s1 |
| InChIKey | VJDSIBXTEUASRZ-RLKGBJSKSA-N |
| XLogP | 1.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|