About 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine
4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine (PubChem CID 70337934) has the molecular formula C14H26ClN3
and a molecular weight of 271.84 g/mol. Its IUPAC name is 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine |
| PubChem CID | 70337934 |
| Molecular Formula | C14H26ClN3 |
| Molecular Weight | 271.84 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine |
| SMILES | CCCCc1nc(Cl)c(C(C)(C)CC(C)(C)N)[nH]1 |
| InChI | InChI=1S/C14H26ClN3/c1-6-7-8-10-17-11(12(15)18-10)13(2,3)9-14(4,5)16/h6-9,16H2,1-5H3,(H,17,18) |
| InChIKey | DXYAZWRPUUHLKC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine?
The IUPAC name of 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine (CID 70337934) is 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine.
What is the SMILES notation for 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine?
The canonical SMILES for 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine is CCCCc1nc(Cl)c(C(C)(C)CC(C)(C)N)[nH]1.
What is the InChIKey of 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine?
The InChIKey is DXYAZWRPUUHLKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26ClN3/c1-6-7-8-10-17-11(12(15)18-10)13(2,3)9-14(4,5)16/h6-9,16H2,1-5H3,(H,17,18).
What are the key properties of 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine?
4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine has a molecular weight of 271.84 g/mol, XLogP of 3.81, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-butyl-4-chloro-1H-imidazol-5-yl)-2,4-dimethylpentan-2-amine is sourced from PubChem (CID 70337934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).