C18H17N7O2 — CID 70338594
3-N-[3-(3,5-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]benzene-1,3-diamine (PubChem CID 70338594) has the molecular formula C18H17N7O2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 3-N-[3-(3,5-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]benzene-1,3-diamine.
| Compound Name | 3-N-[3-(3,5-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 70338594 |
| Molecular Formula | C18H17N7O2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 3-N-[3-(3,5-dimethoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]benzene-1,3-diamine |
| SMILES | COc1cc(OC)cc(-n2nnc3cnc(Nc4cccc(N)c4)nc32)c1 |
| InChI | InChI=1S/C18H17N7O2/c1-26-14-7-13(8-15(9-14)27-2)25-17-16(23-24-25)10-20-18(22-17)21-12-5-3-4-11(19)6-12/h3-10H,19H2,1-2H3,(H,20,21,22) |
| InChIKey | KJMCYJYZWDSTBK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|