About 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine
2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine (PubChem CID 70338609) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine.
Molecular Properties
| Compound Name | 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine |
| PubChem CID | 70338609 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine |
| SMILES | CC1CCN(C2N=CC=CN2)CC1 |
| InChI | InChI=1S/C10H17N3/c1-9-3-7-13(8-4-9)10-11-5-2-6-12-10/h2,5-6,9-11H,3-4,7-8H2,1H3 |
| InChIKey | ALSKAHDSSCVJMF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine?
The IUPAC name of 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine (CID 70338609) is 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine.
What is the SMILES notation for 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine?
The canonical SMILES for 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine is CC1CCN(C2N=CC=CN2)CC1.
What is the InChIKey of 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine?
The InChIKey is ALSKAHDSSCVJMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-9-3-7-13(8-4-9)10-11-5-2-6-12-10/h2,5-6,9-11H,3-4,7-8H2,1H3.
What are the key properties of 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine?
2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine has a molecular weight of 179.27 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylpiperidin-1-yl)-1,2-dihydropyrimidine is sourced from PubChem (CID 70338609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).