About 1-bromo-2,3-dichloro-4-methylsulfinylbenzene
1-bromo-2,3-dichloro-4-methylsulfinylbenzene (PubChem CID 70338673) has the molecular formula C7H5BrCl2OS
and a molecular weight of 287.99 g/mol. Its IUPAC name is 1-bromo-2,3-dichloro-4-methylsulfinylbenzene.
Molecular Properties
| Compound Name | 1-bromo-2,3-dichloro-4-methylsulfinylbenzene |
| PubChem CID | 70338673 |
| Molecular Formula | C7H5BrCl2OS |
| Molecular Weight | 287.99 g/mol |
| Exact Mass | 285.86 |
| IUPAC Name | 1-bromo-2,3-dichloro-4-methylsulfinylbenzene |
| SMILES | CS(=O)c1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C7H5BrCl2OS/c1-12(11)5-3-2-4(8)6(9)7(5)10/h2-3H,1H3 |
| InChIKey | OUVHFHZADUSYDN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.99 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,3-dichloro-4-methylsulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,3-dichloro-4-methylsulfinylbenzene?
The IUPAC name of 1-bromo-2,3-dichloro-4-methylsulfinylbenzene (CID 70338673) is 1-bromo-2,3-dichloro-4-methylsulfinylbenzene.
What is the SMILES notation for 1-bromo-2,3-dichloro-4-methylsulfinylbenzene?
The canonical SMILES for 1-bromo-2,3-dichloro-4-methylsulfinylbenzene is CS(=O)c1ccc(Br)c(Cl)c1Cl.
What is the InChIKey of 1-bromo-2,3-dichloro-4-methylsulfinylbenzene?
The InChIKey is OUVHFHZADUSYDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrCl2OS/c1-12(11)5-3-2-4(8)6(9)7(5)10/h2-3H,1H3.
What are the key properties of 1-bromo-2,3-dichloro-4-methylsulfinylbenzene?
1-bromo-2,3-dichloro-4-methylsulfinylbenzene has a molecular weight of 287.99 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,3-dichloro-4-methylsulfinylbenzene is sourced from PubChem (CID 70338673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).