C29H35BrN2O4S — CID 70338681
[(4aS,6R,8aR)-6-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]-methylamino]-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 70338681) has the molecular formula C29H35BrN2O4S and a molecular weight of 587.58 g/mol. Its IUPAC name is [(4aS,6R,8aR)-6-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]-methylamino]-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [(4aS,6R,8aR)-6-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]-methylamino]-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 70338681 |
| Molecular Formula | C29H35BrN2O4S |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | [(4aS,6R,8aR)-6-[[(E)-3-(4-bromothiophen-2-yl)prop-2-enoyl]-methylamino]-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | CC(=O)O[C@]12CC[C@@H](N(C)C(=O)/C=C/c3cc(Br)cs3)C[C@]1(c1cccc(O)c1)CCN(CC1CC1)C2 |
| InChI | InChI=1S/C29H35BrN2O4S/c1-20(33)36-29-11-10-24(31(2)27(35)9-8-26-15-23(30)18-37-26)16-28(29,22-4-3-5-25(34)14-22)12-13-32(19-29)17-21-6-7-21/h3-5,8-9,14-15,18,21,24,34H,6-7,10-13,16-17,19H2,1-2H3/b9-8+/t24-,28+,29+/m1/s1 |
| InChIKey | JULXFGKSCJCDNZ-OFRHMGEDSA-N |
| XLogP | 5.60 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|