C32H35F3N2O3 — CID 70339347
[3-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-6-[methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoyl]amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 70339347) has the molecular formula C32H35F3N2O3 and a molecular weight of 552.64 g/mol. Its IUPAC name is [3-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-6-[methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoyl]amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-6-[methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoyl]amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 70339347 |
| Molecular Formula | C32H35F3N2O3 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | [3-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-6-[methyl-[3-[4-(trifluoromethyl)phenyl]prop-2-ynoyl]amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc([C@@]23CCN(CC4CC4)C[C@H]2CC[C@@H](N(C)C(=O)C#Cc2ccc(C(F)(F)F)cc2)C3)c1 |
| InChI | InChI=1S/C32H35F3N2O3/c1-22(38)40-29-5-3-4-26(18-29)31-16-17-37(20-24-6-7-24)21-27(31)13-14-28(19-31)36(2)30(39)15-10-23-8-11-25(12-9-23)32(33,34)35/h3-5,8-9,11-12,18,24,27-28H,6-7,13-14,16-17,19-21H2,1-2H3/t27-,28-,31+/m1/s1 |
| InChIKey | YHSAIKRNRUPXJD-WUNLWTINSA-N |
| XLogP | 5.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|