C29H34Cl2N2O4 — CID 70339440
[(4aS,6R,8aR)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate (PubChem CID 70339440) has the molecular formula C29H34Cl2N2O4 and a molecular weight of 545.51 g/mol. Its IUPAC name is [(4aS,6R,8aR)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate.
| Compound Name | [(4aS,6R,8aR)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
|---|---|
| PubChem CID | 70339440 |
| Molecular Formula | C29H34Cl2N2O4 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | [(4aS,6R,8aR)-2-(cyclopropylmethyl)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-4a-(3-hydroxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-8a-yl] acetate |
| SMILES | CC(=O)O[C@]12CC[C@@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)C[C@]1(c1cccc(O)c1)CCN(CC1CC1)C2 |
| InChI | InChI=1S/C29H34Cl2N2O4/c1-19(34)37-29-10-9-23(32-27(36)14-21-7-8-25(30)26(31)13-21)16-28(29,22-3-2-4-24(35)15-22)11-12-33(18-29)17-20-5-6-20/h2-4,7-8,13,15,20,23,35H,5-6,9-12,14,16-18H2,1H3,(H,32,36)/t23-,28+,29+/m1/s1 |
| InChIKey | BWHDQUWJAKKDMD-MGONOCMRSA-N |
| XLogP | 5.27 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |