C10H10N6O4S4-2 — CID 7033955
4-[2-[2-[(4-carboxylato-1,2,5-thiadiazol-3-yl)amino]ethyldisulfanyl]ethylamino]-1,2,5-thiadiazole-3-carboxylate (PubChem CID 7033955) has the molecular formula C10H10N6O4S4-2 and a molecular weight of 406.50 g/mol. Its IUPAC name is 4-[2-[2-[(4-carboxylato-1,2,5-thiadiazol-3-yl)amino]ethyldisulfanyl]ethylamino]-1,2,5-thiadiazole-3-carboxylate.
| Compound Name | 4-[2-[2-[(4-carboxylato-1,2,5-thiadiazol-3-yl)amino]ethyldisulfanyl]ethylamino]-1,2,5-thiadiazole-3-carboxylate |
|---|---|
| PubChem CID | 7033955 |
| Molecular Formula | C10H10N6O4S4-2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 4-[2-[2-[(4-carboxylato-1,2,5-thiadiazol-3-yl)amino]ethyldisulfanyl]ethylamino]-1,2,5-thiadiazole-3-carboxylate |
| SMILES | O=C([O-])c1nsnc1NCCSSCCNc1nsnc1C(=O)[O-] |
| InChI | InChI=1S/C10H12N6O4S4/c17-9(18)5-7(15-23-13-5)11-1-3-21-22-4-2-12-8-6(10(19)20)14-24-16-8/h1-4H2,(H,11,15)(H,12,16)(H,17,18)(H,19,20)/p-2 |
| InChIKey | RIPYTPLCEZKJNE-UHFFFAOYSA-L |
| XLogP | -0.98 |
| TPSA | 155.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|