C5H10N4O — CID 70339648
4-diazenyl-1,3-dimethylimidazolidin-2-one (PubChem CID 70339648) has the molecular formula C5H10N4O and a molecular weight of 142.16 g/mol. Its IUPAC name is 4-diazenyl-1,3-dimethylimidazolidin-2-one.
| Compound Name | 4-diazenyl-1,3-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 70339648 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 4-diazenyl-1,3-dimethylimidazolidin-2-one |
| SMILES | [H]/N=N/C1CN(C)C(=O)N1C |
| InChI | InChI=1S/C5H10N4O/c1-8-3-4(7-6)9(2)5(8)10/h4,6H,3H2,1-2H3/b7-6+ |
| InChIKey | SEAMCWXDRURMFM-VOTSOKGWSA-N |
| XLogP | 0.34 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|