About 4-diazenyl-1,3-dimethylimidazolidin-2-one
4-diazenyl-1,3-dimethylimidazolidin-2-one (PubChem CID 70339648) has the molecular formula C5H10N4O
and a molecular weight of 142.16 g/mol. Its IUPAC name is 4-diazenyl-1,3-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 4-diazenyl-1,3-dimethylimidazolidin-2-one |
| PubChem CID | 70339648 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 4-diazenyl-1,3-dimethylimidazolidin-2-one |
| SMILES | [H]/N=N/C1CN(C)C(=O)N1C |
| InChI | InChI=1S/C5H10N4O/c1-8-3-4(7-6)9(2)5(8)10/h4,6H,3H2,1-2H3/b7-6+ |
| InChIKey | SEAMCWXDRURMFM-VOTSOKGWSA-N |
| XLogP | 0.34 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-diazenyl-1,3-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazenyl-1,3-dimethylimidazolidin-2-one?
The IUPAC name of 4-diazenyl-1,3-dimethylimidazolidin-2-one (CID 70339648) is 4-diazenyl-1,3-dimethylimidazolidin-2-one.
What is the SMILES notation for 4-diazenyl-1,3-dimethylimidazolidin-2-one?
The canonical SMILES for 4-diazenyl-1,3-dimethylimidazolidin-2-one is [H]/N=N/C1CN(C)C(=O)N1C.
What is the InChIKey of 4-diazenyl-1,3-dimethylimidazolidin-2-one?
The InChIKey is SEAMCWXDRURMFM-VOTSOKGWSA-N. The full InChI is InChI=1S/C5H10N4O/c1-8-3-4(7-6)9(2)5(8)10/h4,6H,3H2,1-2H3/b7-6+.
What are the key properties of 4-diazenyl-1,3-dimethylimidazolidin-2-one?
4-diazenyl-1,3-dimethylimidazolidin-2-one has a molecular weight of 142.16 g/mol, XLogP of 0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazenyl-1,3-dimethylimidazolidin-2-one is sourced from PubChem (CID 70339648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).