C19H21N3O7 — CID 70339706
[(3S,5S)-5-[[(2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]pyrrolidin-3-yl] 4-nitrobenzoate (PubChem CID 70339706) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is [(3S,5S)-5-[[(2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]pyrrolidin-3-yl] 4-nitrobenzoate.
| Compound Name | [(3S,5S)-5-[[(2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]pyrrolidin-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 70339706 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(3S,5S)-5-[[(2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]pyrrolidin-3-yl] 4-nitrobenzoate |
| SMILES | C=C[C@@H]1CC1(NC(=O)[C@@H]1C[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)CN1)C(=O)OC |
| InChI | InChI=1S/C19H21N3O7/c1-3-12-9-19(12,18(25)28-2)21-16(23)15-8-14(10-20-15)29-17(24)11-4-6-13(7-5-11)22(26)27/h3-7,12,14-15,20H,1,8-10H2,2H3,(H,21,23)/t12-,14+,15+,19?/m1/s1 |
| InChIKey | HTUAQHRXDKQSNH-YSFLVDIYSA-N |
| XLogP | 0.72 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|