C11H23N3 — CID 70339920
N,N-dimethyl-1-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanamine (PubChem CID 70339920) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is N,N-dimethyl-1-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanamine |
|---|---|
| PubChem CID | 70339920 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | N,N-dimethyl-1-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanamine |
| SMILES | CC1CNC2NCC(CN(C)C)C2C1 |
| InChI | InChI=1S/C11H23N3/c1-8-4-10-9(7-14(2)3)6-13-11(10)12-5-8/h8-13H,4-7H2,1-3H3 |
| InChIKey | JOPAFRPJZDYRML-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |