C31H34F2N2O5 — CID 70340762
4-[6,6-bis(4-fluorophenyl)hexanoyl]-1-[(3-hydroxy-4,5-dimethoxyphenyl)methyl]piperazin-2-one (PubChem CID 70340762) has the molecular formula C31H34F2N2O5 and a molecular weight of 552.62 g/mol. Its IUPAC name is 4-[6,6-bis(4-fluorophenyl)hexanoyl]-1-[(3-hydroxy-4,5-dimethoxyphenyl)methyl]piperazin-2-one.
| Compound Name | 4-[6,6-bis(4-fluorophenyl)hexanoyl]-1-[(3-hydroxy-4,5-dimethoxyphenyl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 70340762 |
| Molecular Formula | C31H34F2N2O5 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 4-[6,6-bis(4-fluorophenyl)hexanoyl]-1-[(3-hydroxy-4,5-dimethoxyphenyl)methyl]piperazin-2-one |
| SMILES | COc1cc(CN2CCN(C(=O)CCCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2=O)cc(O)c1OC |
| InChI | InChI=1S/C31H34F2N2O5/c1-39-28-18-21(17-27(36)31(28)40-2)19-34-15-16-35(20-30(34)38)29(37)6-4-3-5-26(22-7-11-24(32)12-8-22)23-9-13-25(33)14-10-23/h7-14,17-18,26,36H,3-6,15-16,19-20H2,1-2H3 |
| InChIKey | YHABQUCUYJDDKS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|