C30H37N7O4 — CID 70341186
3,4-dimethoxyaniline;N-[(3,4-dimethoxyphenyl)methyl]-4-(6-piperazin-1-yl-3-pyridinyl)pyrimidin-2-amine (PubChem CID 70341186) has the molecular formula C30H37N7O4 and a molecular weight of 559.67 g/mol. Its IUPAC name is 3,4-dimethoxyaniline;N-[(3,4-dimethoxyphenyl)methyl]-4-(6-piperazin-1-yl-3-pyridinyl)pyrimidin-2-amine.
| Compound Name | 3,4-dimethoxyaniline;N-[(3,4-dimethoxyphenyl)methyl]-4-(6-piperazin-1-yl-3-pyridinyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 70341186 |
| Molecular Formula | C30H37N7O4 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | 3,4-dimethoxyaniline;N-[(3,4-dimethoxyphenyl)methyl]-4-(6-piperazin-1-yl-3-pyridinyl)pyrimidin-2-amine |
| SMILES | COc1ccc(CNc2nccc(-c3ccc(N4CCNCC4)nc3)n2)cc1OC.COc1ccc(N)cc1OC |
| InChI | InChI=1S/C22H26N6O2.C8H11NO2/c1-29-19-5-3-16(13-20(19)30-2)14-26-22-24-8-7-18(27-22)17-4-6-21(25-15-17)28-11-9-23-10-12-28;1-10-7-4-3-6(9)5-8(7)11-2/h3-8,13,15,23H,9-12,14H2,1-2H3,(H,24,26,27);3-5H,9H2,1-2H3 |
| InChIKey | CWBGCTNIPICSOC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|